cas: 764667-65-4 — see every product listed under this CAS number, including other names
1-[5,6-DIHYDRO-3-(TRIFLUOROMETHYL)-1,2,4-TRIAZOLO[4,3-A]PYRAZIN-7(8H)-YL]-4-(2,4,5-TRIFLUOROPHENYL)-1,3-BUTANEDIONE, 95% (CAS 764667-65-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817914-5G |
| cas | 764667-65-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 232.23 Pln | |
| Fluorochem | 100g | 643.54 Pln | |
| Fluorochem | 500g | 2439.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione (CAS 764667-65-4) is a chemical compound with the molecular formula C16H12F6N4O2 and a molecular weight of 406.28 g/mol. IUPAC name: 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione. InChIKey: QAEDTLFWHIEVPK-UHFFFAOYSA-N.
| Molecular formula | C16H12F6N4O2 |
|---|---|
| Molecular weight | 406.28 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
| InChIKey | QAEDTLFWHIEVPK-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)CC(=O)CC3=CC(=C(C=C3F)F)F |
Computed by PubChem (NCBI)