cas: 86801-04-9 — see every product listed under this CAS number, including other names
1-(3-Acetylphenyl)thiourea 95% (CAS 86801-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A367115-250mg |
| cas | 86801-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 398.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A367115 |
(3-acetylphenyl)thiourea (CAS 86801-04-9) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: (3-acetylphenyl)thiourea. InChIKey: NTHCFGIAOBBZFD-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | (3-acetylphenyl)thiourea |
| InChIKey | NTHCFGIAOBBZFD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=S)N |
Computed by PubChem (NCBI)