cas: 86801-04-9 — see every product listed under this CAS number, including other names
1-(3-Acetylphenyl)-2-thiourea, 95%, 95% (CAS 86801-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115J4I-100mg |
| cas | 86801-04-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 352.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3-acetylphenyl)thiourea (CAS 86801-04-9) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: (3-acetylphenyl)thiourea. InChIKey: NTHCFGIAOBBZFD-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | (3-acetylphenyl)thiourea |
| InChIKey | NTHCFGIAOBBZFD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=S)N |
Computed by PubChem (NCBI)