1-(3-Bromo-5-(trifluoromethyl)phenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%
cas: 1532639-55-6 — see every product listed under this CAS number, including other names
1-(3-Bromo-5-(trifluoromethyl)phenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95% (CAS 1532639-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A2835353-250mg |
| cas | 1532639-55-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 615.13 Pln | |
| Ambeed | 5g | 2244.94 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 658.68 Pln | |
| BLDpharm | 5g | 2413.62 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Fluorochem | 1g | 622.72 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione (CAS 1532639-55-6) is a chemical compound with the molecular formula C11H8BrF3N2O2 and a molecular weight of 337.09 g/mol. IUPAC name: 1-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione. InChIKey: JJLFCHRTXZQBPI-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3N2O2 |
|---|---|
| Molecular weight | 337.09 g/mol |
| IUPAC name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione |
| InChIKey | JJLFCHRTXZQBPI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)