Products 1532639-55-6
CAS 1532639-55-6 appears in our catalog under these names: 1-(3-Bromo-5-(trifluoromethyl)phenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 1-(3-Bromo-5-(trifluoromethyl)phenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
1-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione (CAS 1532639-55-6) is a chemical compound with the molecular formula C11H8BrF3N2O2 and a molecular weight of 337.09 g/mol. IUPAC name: 1-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione. InChIKey: JJLFCHRTXZQBPI-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3N2O2 |
|---|---|
| Molecular weight | 337.09 g/mol |
| IUPAC name | 1-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-diazinane-2,4-dione |
| InChIKey | JJLFCHRTXZQBPI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)