cas: 2415-93-2 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)-2-methylpropan-1-one, 98% (CAS 2415-93-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A164332-25g |
| cas | 2415-93-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 8279.11 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 1851.45 Pln | |
| Fluorochem | 25g | 3824.71 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(3-bromophenyl)-2-methylpropan-1-one (CAS 2415-93-2) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 1-(3-bromophenyl)-2-methylpropan-1-one. InChIKey: NHXAYTCRAVHZQZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2-methylpropan-1-one |
| InChIKey | NHXAYTCRAVHZQZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)