CAS 88174-27-0 appears in our catalog under these names: 3-bromo-2,4,6-trimethylbenzaldehyde, 95%, 3-Bromo-2,4,6-trimethylbenzaldehyde, 3-Bromo-2,4,6-trimethylbenzaldehyde, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg.
3-bromo-2,4,6-trimethylbenzaldehyde (CAS 88174-27-0) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 3-bromo-2,4,6-trimethylbenzaldehyde. InChIKey: GHWCNWQBTMHJKU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 3-bromo-2,4,6-trimethylbenzaldehyde |
| InChIKey | GHWCNWQBTMHJKU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C=O)C)Br)C |
Computed by PubChem (NCBI)