cas: 1098349-39-3 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)cyclobutanamine, 97%, 97% (CAS 1098349-39-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBME-100mg |
| cas | 1098349-39-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1422.80 Pln | |
| Chemat | 5g | 4072.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromophenyl)cyclobutan-1-amine (CAS 1098349-39-3) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: 1-(3-bromophenyl)cyclobutan-1-amine. InChIKey: WIXMLWFYSVFSNY-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclobutan-1-amine |
| InChIKey | WIXMLWFYSVFSNY-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)