cas: 194943-82-3 — see every product listed under this CAS number, including other names
1-(3-Chloro-4-fluorophenyl)propan-1-one (CAS 194943-82-3) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226481-10G |
| cas | 194943-82-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 2434.58 Pln |
| delivery time | 2-3 weeks |
|---|
1-(3-chloro-4-fluorophenyl)propan-1-one (CAS 194943-82-3) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)propan-1-one. InChIKey: LHPIDZXCWYJUDU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)propan-1-one |
| InChIKey | LHPIDZXCWYJUDU-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)