Products 886496-66-8
CAS 886496-66-8 is the registry number for 3'-Chloro-5'-fluoropropiophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
1-(3-chloro-5-fluorophenyl)propan-1-one (CAS 886496-66-8) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(3-chloro-5-fluorophenyl)propan-1-one. InChIKey: ACOVATHOZRDABU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(3-chloro-5-fluorophenyl)propan-1-one |
| InChIKey | ACOVATHOZRDABU-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=CC(=C1)Cl)F |
Computed by PubChem (NCBI)