cas: 1256360-48-1 — see every product listed under this CAS number, including other names
1-(3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarbonitrile 96% (CAS 1256360-48-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142791-100mg |
| cas | 1256360-48-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 10g | 3463.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A142791 |
1-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carbonitrile (CAS 1256360-48-1) is a chemical compound with the molecular formula C16H19BClNO2 and a molecular weight of 303.6 g/mol. IUPAC name: 1-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carbonitrile. InChIKey: HIBAVNIZBCSVPA-UHFFFAOYSA-N.
| Molecular formula | C16H19BClNO2 |
|---|---|
| Molecular weight | 303.6 g/mol |
| IUPAC name | 1-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | HIBAVNIZBCSVPA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C3(CC3)C#N |
Computed by PubChem (NCBI)