cas: 1256360-48-1 — see every product listed under this CAS number, including other names
1-(3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarbonitrile, 96%, 96% (CAS 1256360-48-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O9J-100mg |
| cas | 1256360-48-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3506.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carbonitrile (CAS 1256360-48-1) is a chemical compound with the molecular formula C16H19BClNO2 and a molecular weight of 303.6 g/mol. IUPAC name: 1-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carbonitrile. InChIKey: HIBAVNIZBCSVPA-UHFFFAOYSA-N.
| Molecular formula | C16H19BClNO2 |
|---|---|
| Molecular weight | 303.6 g/mol |
| IUPAC name | 1-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | HIBAVNIZBCSVPA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C3(CC3)C#N |
Computed by PubChem (NCBI)