cas: 114067-96-8 — see every product listed under this CAS number, including other names
1-(3-Chlorophenyl)-1H-imidazole-4-carboxylic acid, 97% (CAS 114067-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A505356-100mg |
| cas | 114067-96-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 603.82 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1596.33 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(3-chlorophenyl)imidazole-4-carboxylic acid (CAS 114067-96-8) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 1-(3-chlorophenyl)imidazole-4-carboxylic acid. InChIKey: HHWKHAWQTUZKNW-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 1-(3-chlorophenyl)imidazole-4-carboxylic acid |
| InChIKey | HHWKHAWQTUZKNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C=C(N=C2)C(=O)O |
Computed by PubChem (NCBI)