CAS 1124194-70-2 appears in our catalog under these names: methyl 2–chloro–1,7–naphthyridine–3–carboxylate, 1,7-Naphthyridine-3-carboxylic acid, 2-chloro-, methyl ester, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-chloro-1,7-naphthyridine-3-carboxylate (CAS 1124194-70-2) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: methyl 2-chloro-1,7-naphthyridine-3-carboxylate. InChIKey: FPHFESONIRHOJV-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | methyl 2-chloro-1,7-naphthyridine-3-carboxylate |
| InChIKey | FPHFESONIRHOJV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C2C=NC=CC2=C1)Cl |
Computed by PubChem (NCBI)