CAS 1447839-64-6 is the registry number for 1-(4,6-Dichloro-2-(methylthio)pyrimidin-5-yl)ethanone, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
1-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)ethanone (CAS 1447839-64-6) is a chemical compound with the molecular formula C7H6Cl2N2OS and a molecular weight of 237.11 g/mol. IUPAC name: 1-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)ethanone. InChIKey: DUNQUDGJBRHJTE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2OS |
|---|---|
| Molecular weight | 237.11 g/mol |
| IUPAC name | 1-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)ethanone |
| InChIKey | DUNQUDGJBRHJTE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(N=C1Cl)SC)Cl |
Computed by PubChem (NCBI)