CAS 1240673-08-8 is the registry number for 1-(3,5-Dichloro-4-hydroxyphenyl)thiourea, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(3,5-dichloro-4-hydroxyphenyl)thiourea (CAS 1240673-08-8) is a chemical compound with the molecular formula C7H6Cl2N2OS and a molecular weight of 237.11 g/mol. IUPAC name: (3,5-dichloro-4-hydroxyphenyl)thiourea. InChIKey: RDQFGLNYAFHKEC-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2OS |
|---|---|
| Molecular weight | 237.11 g/mol |
| IUPAC name | (3,5-dichloro-4-hydroxyphenyl)thiourea |
| InChIKey | RDQFGLNYAFHKEC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)NC(=S)N |
Computed by PubChem (NCBI)