cas: 1341829-72-8 — see every product listed under this CAS number, including other names
1-(4-(4-Iodo-1h-pyrazol-1-yl)phenyl)ethan-1-one, 95% (CAS 1341829-72-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch130HVQ-50mg |
| cas | 1341829-72-8 |
| size | 50mg |
| availability | 18g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 6765.20 Pln | |
| Chemat | 100mg | 7072.40 Pln | |
| Chemat | 250mg | 7398.80 Pln | |
| Chemat | 500mg | 7715.60 Pln | |
| Chemat | 1g | 8022.80 Pln | |
| Fluorochem | 50mg | 258.26 Pln | |
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 950.72 Pln | |
| Fluorochem | 500mg | 1736.91 Pln | |
| Fluorochem | 1g | 2299.21 Pln | |
| Fluorochem | 2.5g | 4454.70 Pln | |
| Fluorochem | 5g | 6433.17 Pln | |
| Fluorochem | 10g | 9520.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-(4-iodopyrazol-1-yl)phenyl]ethanone (CAS 1341829-72-8) is a chemical compound with the molecular formula C11H9IN2O and a molecular weight of 312.11 g/mol. IUPAC name: 1-[4-(4-iodopyrazol-1-yl)phenyl]ethanone. InChIKey: ZQQIOPNRSJLAIH-UHFFFAOYSA-N.
| Molecular formula | C11H9IN2O |
|---|---|
| Molecular weight | 312.11 g/mol |
| IUPAC name | 1-[4-(4-iodopyrazol-1-yl)phenyl]ethanone |
| InChIKey | ZQQIOPNRSJLAIH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C=C(C=N2)I |
Computed by PubChem (NCBI)