cas: 124276-61-5 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethyl)phenyl)cyclopropanecarbonitrile, 97%, 97% (CAS 124276-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LSG-100mg |
| cas | 124276-61-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 5g | 1466.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile (CAS 124276-61-5) is a chemical compound with the molecular formula C11H8F3N and a molecular weight of 211.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile. InChIKey: WGLHDYUQTLHLHA-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | WGLHDYUQTLHLHA-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)