cas: 124276-61-5 — see every product listed under this CAS number, including other names
1-[4-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile, 97% (CAS 124276-61-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F403298-250MG |
| cas | 124276-61-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1565.09 Pln | |
| Fluorochem | 10g | 3043.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile (CAS 124276-61-5) is a chemical compound with the molecular formula C11H8F3N and a molecular weight of 211.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile. InChIKey: WGLHDYUQTLHLHA-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile |
| InChIKey | WGLHDYUQTLHLHA-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)