cas: 22589-50-0 — see every product listed under this CAS number, including other names
1-(4-Amino-3,5-dibromophenyl)ethanone 98% (CAS 22589-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A492623-100mg |
| cas | 22589-50-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 2239.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A492623 |
1-(4-amino-3,5-dibromophenyl)ethanone (CAS 22589-50-0) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 1-(4-amino-3,5-dibromophenyl)ethanone. InChIKey: GDOXBJMFPXRNPM-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 1-(4-amino-3,5-dibromophenyl)ethanone |
| InChIKey | GDOXBJMFPXRNPM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Br)N)Br |
Computed by PubChem (NCBI)