cas: 22589-50-0 — see every product listed under this CAS number, including other names
1-(4-Amino-3,5-dibromo-phenyl)-ethanone, 98%, 98% (CAS 22589-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFHO-100mg |
| cas | 22589-50-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 309.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-amino-3,5-dibromophenyl)ethanone (CAS 22589-50-0) is a chemical compound with the molecular formula C8H7Br2NO and a molecular weight of 292.95 g/mol. IUPAC name: 1-(4-amino-3,5-dibromophenyl)ethanone. InChIKey: GDOXBJMFPXRNPM-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO |
|---|---|
| Molecular weight | 292.95 g/mol |
| IUPAC name | 1-(4-amino-3,5-dibromophenyl)ethanone |
| InChIKey | GDOXBJMFPXRNPM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Br)N)Br |
Computed by PubChem (NCBI)