cas: 142752-12-3 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)Piperidin-4-Ol, 97%, 97% (CAS 142752-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118KNF-100mg |
| cas | 142752-12-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1341.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-aminophenyl)piperidin-4-ol (CAS 142752-12-3) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 1-(4-aminophenyl)piperidin-4-ol. InChIKey: BJXPIIDUCADEKU-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 1-(4-aminophenyl)piperidin-4-ol |
| InChIKey | BJXPIIDUCADEKU-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)