CAS 86847-77-0 appears in our catalog under these names: 2,2-Dimethyl-n-(4-methyl-pyridin-2-yl)-propionamide, 95%, 2,2-Dimethyl-n-(4-methyl-pyridin-2-yl)-propionamide, >98%, >98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide (CAS 86847-77-0) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide. InChIKey: GMKUFMYZJOPWSH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 2,2-dimethyl-N-(4-methyl-2-pyridinyl)propanamide |
| InChIKey | GMKUFMYZJOPWSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)