cas: 180698-19-5 — see every product listed under this CAS number, including other names
1-(4-Biphenylyl)piperazine, 97% (CAS 180698-19-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009753-5G |
| cas | 180698-19-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2132.60 Pln | |
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 690.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
1-(4-phenylphenyl)piperazine (CAS 180698-19-5) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 1-(4-phenylphenyl)piperazine. InChIKey: OAKBDDKEEOAXNV-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 1-(4-phenylphenyl)piperazine |
| InChIKey | OAKBDDKEEOAXNV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)