cas: 180698-19-5 — see every product listed under this CAS number, including other names
1-Biphenyl-4-yl-piperazine, 97%, 97% (CAS 180698-19-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113390-100mg |
| cas | 180698-19-5 |
| size | 100mg |
| availability | 65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 2032.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-phenylphenyl)piperazine (CAS 180698-19-5) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 1-(4-phenylphenyl)piperazine. InChIKey: OAKBDDKEEOAXNV-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 1-(4-phenylphenyl)piperazine |
| InChIKey | OAKBDDKEEOAXNV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)