cas: 72652-32-5 — see every product listed under this CAS number, including other names
1-(4-Bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone, 95%, 95% (CAS 72652-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116FO1-100mg |
| cas | 72652-32-5 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 894.80 Pln | |
| Chemat | 25g | 2666.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone (CAS 72652-32-5) is a chemical compound with the molecular formula C6H3BrCl3NO and a molecular weight of 291.4 g/mol. IUPAC name: 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone. InChIKey: CQLTVLIUJXOOGD-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl3NO |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone |
| InChIKey | CQLTVLIUJXOOGD-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C1Br)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)