CAS 2655608-54-9 is the registry number for 2-Bromo-4,5,6-trichloro-3-methoxypyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-bromo-4,5,6-trichloro-3-methoxypyridine (CAS 2655608-54-9) is a chemical compound with the molecular formula C6H3BrCl3NO and a molecular weight of 291.4 g/mol. IUPAC name: 2-bromo-4,5,6-trichloro-3-methoxypyridine. InChIKey: SLGAWMHJAWCMKI-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl3NO |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 2-bromo-4,5,6-trichloro-3-methoxypyridine |
| InChIKey | SLGAWMHJAWCMKI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(N=C1Br)Cl)Cl)Cl |
Computed by PubChem (NCBI)