cas: 1197231-94-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-(trifluoromethyl)phenyl)ethanone 95% (CAS 1197231-94-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A465593-250mg |
| cas | 1197231-94-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A465593 |
1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone (CAS 1197231-94-9) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone. InChIKey: FBMIDZPWGMPHMY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone |
| InChIKey | FBMIDZPWGMPHMY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)