cas: 1197231-94-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-(trifluoromethyl)phenyl)ethanone, 98%, 98% (CAS 1197231-94-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PJD-10g |
| cas | 1197231-94-9 |
| size | 10g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1509.20 Pln | |
| Chemat | 25g | 3683.60 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 928.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone (CAS 1197231-94-9) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone. InChIKey: FBMIDZPWGMPHMY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-[4-bromo-2-(trifluoromethyl)phenyl]ethanone |
| InChIKey | FBMIDZPWGMPHMY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)