cas: 1394291-56-5 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-chlorobenzyl)pyrrolidine hydrochloride (CAS 1394291-56-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632258-1G |
| cas | 1394291-56-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2439.78 Pln | |
| Fluorochem | 5g | 7182.91 Pln |
| delivery time | 3-4 weeks |
|---|
1-[(4-bromo-2-chlorophenyl)methyl]pyrrolidine;hydrochloride (CAS 1394291-56-5) is a chemical compound with the molecular formula C11H14BrCl2N and a molecular weight of 311.04 g/mol. IUPAC name: 1-[(4-bromo-2-chlorophenyl)methyl]pyrrolidine;hydrochloride. InChIKey: JAMDMYIKEXLAMS-UHFFFAOYSA-N.
| Molecular formula | C11H14BrCl2N |
|---|---|
| Molecular weight | 311.04 g/mol |
| IUPAC name | 1-[(4-bromo-2-chlorophenyl)methyl]pyrrolidine;hydrochloride |
| InChIKey | JAMDMYIKEXLAMS-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=C(C=C(C=C2)Br)Cl.Cl |
Computed by PubChem (NCBI)