Products 1334500-00-3

CAS 1334500-00-3 is the registry number for 1-Bromo-3-chloro-5-piperidinobenzene hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(3-bromo-5-chlorophenyl)piperidine;hydrochloride (CAS 1334500-00-3) is a chemical compound with the molecular formula C11H14BrCl2N and a molecular weight of 311.04 g/mol. IUPAC name: 1-(3-bromo-5-chlorophenyl)piperidine;hydrochloride. InChIKey: WRNKGLMNNAWBDV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14BrCl2N
Molecular weight311.04 g/mol
IUPAC name1-(3-bromo-5-chlorophenyl)piperidine;hydrochloride
InChIKeyWRNKGLMNNAWBDV-UHFFFAOYSA-N
SMILESC1CCN(CC1)C2=CC(=CC(=C2)Br)Cl.Cl

Computed by PubChem (NCBI)