CAS 1334500-00-3 is the registry number for 1-Bromo-3-chloro-5-piperidinobenzene hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-(3-bromo-5-chlorophenyl)piperidine;hydrochloride (CAS 1334500-00-3) is a chemical compound with the molecular formula C11H14BrCl2N and a molecular weight of 311.04 g/mol. IUPAC name: 1-(3-bromo-5-chlorophenyl)piperidine;hydrochloride. InChIKey: WRNKGLMNNAWBDV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrCl2N |
|---|---|
| Molecular weight | 311.04 g/mol |
| IUPAC name | 1-(3-bromo-5-chlorophenyl)piperidine;hydrochloride |
| InChIKey | WRNKGLMNNAWBDV-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=CC(=C2)Br)Cl.Cl |
Computed by PubChem (NCBI)