cas: 1291487-17-6 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-chlorophenyl)pyrrolidin-2-one, 98%, 98% (CAS 1291487-17-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YVS-1g |
| cas | 1291487-17-6 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 933.20 Pln | |
| Chemat | 5g | 2680.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-3-chlorophenyl)pyrrolidin-2-one (CAS 1291487-17-6) is a chemical compound with the molecular formula C10H9BrClNO and a molecular weight of 274.54 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)pyrrolidin-2-one. InChIKey: HAYOWYDCYKXKDO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)pyrrolidin-2-one |
| InChIKey | HAYOWYDCYKXKDO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)