CAS 1408076-10-7 is the registry number for 6-Bromo-8-chloro-1-methyl-1,2,3,4-tetrahydroquinolin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-8-chloro-1-methyl-3,4-dihydroquinolin-2-one (CAS 1408076-10-7) is a chemical compound with the molecular formula C10H9BrClNO and a molecular weight of 274.54 g/mol. IUPAC name: 6-bromo-8-chloro-1-methyl-3,4-dihydroquinolin-2-one. InChIKey: DOZMVZVHNXPXHC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 6-bromo-8-chloro-1-methyl-3,4-dihydroquinolin-2-one |
| InChIKey | DOZMVZVHNXPXHC-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC2=C1C(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)