cas: 131895-07-3 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-3-methylbutan-1-one 98% (CAS 131895-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A517794-100mg |
| cas | 131895-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A517794 |
1-(4-bromophenyl)-3-methylbutan-1-one (CAS 131895-07-3) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-(4-bromophenyl)-3-methylbutan-1-one. InChIKey: XNZHSJUQYSQITA-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-methylbutan-1-one |
| InChIKey | XNZHSJUQYSQITA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)