CAS 30314-45-5 appears in our catalog under these names: 1-(4-Bromophenyl)-2,2-dimethylpropan-1-one, 95%, 4'-Bromo-2,2-dimethylpropiophenone, 1-(4-Bromophenyl)-2,2-dimethylpropan-1-one, 97%,RG, 97%,RG, 4'-Bromo-2,2-dimethylpropiophenone, 97%, 1-(4-Bromophenyl)-2,2-dimethylpropan-1-one, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 2,5g, 100mg.
1-(4-bromophenyl)-2,2-dimethylpropan-1-one (CAS 30314-45-5) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2-dimethylpropan-1-one. InChIKey: LFGBQDTUMQMUQJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | LFGBQDTUMQMUQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)