cas: 130307-08-3 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-4-Methylpiperazine, 97%, 97% (CAS 130307-08-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111U0E-250mg |
| cas | 130307-08-3 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 25g | 458.00 Pln | |
| Chemat | 100g | 1365.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)-4-methylpiperazine (CAS 130307-08-3) is a chemical compound with the molecular formula C11H15BrN2 and a molecular weight of 255.15 g/mol. IUPAC name: 1-(4-bromophenyl)-4-methylpiperazine. InChIKey: WCOODAWUEIXTFL-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2 |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-methylpiperazine |
| InChIKey | WCOODAWUEIXTFL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)