Products 2140327-15-5
CAS 2140327-15-5 is the registry number for 1-(4-Bromophenyl)-4-(methyl-d3)piperazine, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromophenyl)-4-(trideuteriomethyl)piperazine (CAS 2140327-15-5) is a chemical compound with the molecular formula C11H15BrN2 and a molecular weight of 258.17 g/mol. IUPAC name: 1-(4-bromophenyl)-4-(trideuteriomethyl)piperazine. InChIKey: WCOODAWUEIXTFL-FIBGUPNXSA-N.
| Molecular formula | C11H15BrN2 |
|---|---|
| Molecular weight | 258.17 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-(trideuteriomethyl)piperazine |
| InChIKey | WCOODAWUEIXTFL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)