cas: 865204-03-1 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)cyclopentanol (CAS 865204-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631832-1G |
| cas | 865204-03-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1268.32 Pln | |
| Fluorochem | 5g | 3673.72 Pln |
| delivery time | 3-4 weeks |
|---|
1-(4-bromophenyl)cyclopentan-1-ol (CAS 865204-03-1) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-(4-bromophenyl)cyclopentan-1-ol. InChIKey: KXEZRQJDHKLSHF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclopentan-1-ol |
| InChIKey | KXEZRQJDHKLSHF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)