cas: 7295-46-7 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)hexan-1-one, 98%, 98% (CAS 7295-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116D2J-250mg |
| cas | 7295-46-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)hexan-1-one (CAS 7295-46-7) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 1-(4-bromophenyl)hexan-1-one. InChIKey: MVLMRPWLTMFPJI-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(4-bromophenyl)hexan-1-one |
| InChIKey | MVLMRPWLTMFPJI-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)