CAS 30095-47-7 appears in our catalog under these names: 2-Bromo-1-(4-tert-butyl-phenyl)-ethanone, 98%, 2-Bromo-4'-tert-butylacetophenone, 2–Bromo–1–(4–(tert–butyl)phenyl)ethanone. Offered by: Combi-blocks, TRC, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 2,5g.
2-bromo-1-(4-tert-butylphenyl)ethanone (CAS 30095-47-7) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 2-bromo-1-(4-tert-butylphenyl)ethanone. InChIKey: GCJWEWNNECJKPG-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 2-bromo-1-(4-tert-butylphenyl)ethanone |
| InChIKey | GCJWEWNNECJKPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)