cas: 68104-62-1 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)piperazine (hydrochloride), 98.58% (CAS 68104-62-1) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g, 50 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W040491-25 g |
| cas | 68104-62-1 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 621.55 Pln | |
| MedChemExpress | 100 g | 1415.68 Pln | |
| MedChemExpress | 50 g | 928.06 Pln | |
| MedChemExpress | 5 g | 263.96 Pln | |
| MedChemExpress | 10 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.58% |
1-(4-bromophenyl)piperazine;hydrochloride (CAS 68104-62-1) is a chemical compound with the molecular formula C10H14BrClN2 and a molecular weight of 277.59 g/mol. IUPAC name: 1-(4-bromophenyl)piperazine;hydrochloride. InChIKey: YDVSFRZKQMQPJD-UHFFFAOYSA-N.
| Molecular formula | C10H14BrClN2 |
|---|---|
| Molecular weight | 277.59 g/mol |
| IUPAC name | 1-(4-bromophenyl)piperazine;hydrochloride |
| InChIKey | YDVSFRZKQMQPJD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)