cas: 837-12-7 — see every product listed under this CAS number, including other names
1-(4-Bromophenylsulfonyl)-4-methylpiperazine, 98%, 98% (CAS 837-12-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119IHT-1g |
| cas | 837-12-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 25g | 2421.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)sulfonyl-4-methylpiperazine (CAS 837-12-7) is a chemical compound with the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-4-methylpiperazine. InChIKey: CBNDEXDYZUNXBF-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2S |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-4-methylpiperazine |
| InChIKey | CBNDEXDYZUNXBF-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)