CAS 1582141-75-0 is the registry number for 1-((4-Bromophenyl)sulfonyl)piperidin-4-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)sulfonylpiperidin-4-amine (CAS 1582141-75-0) is a chemical compound with the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonylpiperidin-4-amine. InChIKey: VBOGRHUUADZIJT-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2S |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonylpiperidin-4-amine |
| InChIKey | VBOGRHUUADZIJT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)