CAS 1854041-28-3 is the registry number for 1-(4-Chloro-5-formylthiazol-2-yl)azetidine-3-carboxamide, 95%. Offered by: Ambeed. Available pack sizes: 1g, 250mg.
1-(4-chloro-5-formyl-1,3-thiazol-2-yl)azetidine-3-carboxamide (CAS 1854041-28-3) is a chemical compound with the molecular formula C8H8ClN3O2S and a molecular weight of 245.69 g/mol. IUPAC name: 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)azetidine-3-carboxamide. InChIKey: OLWMAOQKDUXPNC-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2S |
|---|---|
| Molecular weight | 245.69 g/mol |
| IUPAC name | 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)azetidine-3-carboxamide |
| InChIKey | OLWMAOQKDUXPNC-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC(=C(S2)C=O)Cl)C(=O)N |
Computed by PubChem (NCBI)