cas: 63874-99-7 — see every product listed under this CAS number, including other names
1-(4-Chloro-phenyl)-1H-pyrazole-4-carbaldehyde, 98% (CAS 63874-99-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F058631-250MG |
| cas | 63874-99-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 500mg | 289.50 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 2.5g | 685.19 Pln | |
| Fluorochem | 5g | 810.15 Pln | |
| Fluorochem | 10g | 1559.89 Pln | |
| Fluorochem | 25g | 3387.37 Pln | |
| Fluorochem | 100g | 7932.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-chlorophenyl)pyrazole-4-carbaldehyde (CAS 63874-99-7) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 1-(4-chlorophenyl)pyrazole-4-carbaldehyde. InChIKey: VZQVRKCGPMBZQL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pyrazole-4-carbaldehyde |
| InChIKey | VZQVRKCGPMBZQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)C=O)Cl |
Computed by PubChem (NCBI)