CAS 124041-00-5 appears in our catalog under these names: 4-Phenoxy-6-chloropyrimidine, 95%, 4–Chloro–6–phenoxypyrimidine, 4-Chloro-6-phenoxypyrimidine 95%, 4-Chloro-6-phenoxypyrimidine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
4-chloro-6-phenoxypyrimidine (CAS 124041-00-5) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 4-chloro-6-phenoxypyrimidine. InChIKey: KHGWFZBIISKKRP-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 4-chloro-6-phenoxypyrimidine |
| InChIKey | KHGWFZBIISKKRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)