cas: 24437-48-7 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-2-(methylsulfonyl)ethanone (CAS 24437-48-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023415-1G |
| cas | 24437-48-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 10g | 2299.21 Pln | |
| Fluorochem | 25g | 5048.24 Pln |
| delivery time | 2-3 weeks |
|---|
1-(4-chlorophenyl)-2-methylsulfonylethanone (CAS 24437-48-7) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-methylsulfonylethanone. InChIKey: LXWVEFAAYCFRPS-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-methylsulfonylethanone |
| InChIKey | LXWVEFAAYCFRPS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)