Products 1152558-85-4

CAS 1152558-85-4 appears in our catalog under these names: 3-Propanoylbenzene-1-sulfonyl chloride, 95%, 3-Propanoylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

3-propanoylbenzenesulfonyl chloride (CAS 1152558-85-4) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: 3-propanoylbenzenesulfonyl chloride. InChIKey: VVGMPCDOSJNYLL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO3S
Molecular weight232.68 g/mol
IUPAC name3-propanoylbenzenesulfonyl chloride
InChIKeyVVGMPCDOSJNYLL-UHFFFAOYSA-N
SMILESCCC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)