cas: 774-86-7 — see every product listed under this CAS number, including other names
1-(4-Fluoro-3-nitrophenyl)ethanol, ≥97%, ≥97% (CAS 774-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLQC-100mg |
| cas | 774-86-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| Chemat | 5g | 2790.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1-(4-fluoro-3-nitrophenyl)ethanol (CAS 774-86-7) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 1-(4-fluoro-3-nitrophenyl)ethanol. InChIKey: IACYNVDAYQTIKW-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 1-(4-fluoro-3-nitrophenyl)ethanol |
| InChIKey | IACYNVDAYQTIKW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)