CAS 637347-90-1 appears in our catalog under these names: 2-Amino-4-fluoro-5-methoxybenzoic acid, 98%, 2-Amino-4-fluoro-5-methoxybenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
2-amino-4-fluoro-5-methoxybenzoic acid (CAS 637347-90-1) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-amino-4-fluoro-5-methoxybenzoic acid. InChIKey: IRDKEEYUZLEIGW-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-amino-4-fluoro-5-methoxybenzoic acid |
| InChIKey | IRDKEEYUZLEIGW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N)F |
Computed by PubChem (NCBI)